| Catalog Number |
ACM750590182 |
| CAS |
750590-18-2 |
| Structure |
![{[CAS...OR...Name]}](https://resource.alfa-chemistry.com/structure/750590-18-2.gif) |
| Description |
Tropodithietic acid is a sulfur-containing antibiotic produced by the marine bacterium Phaeobacter inhibens. |
| Synonyms |
Tropodithietic acid [TDA] |
| IUPAC Name |
3-Oxo-8,9-dithiabicyclo[5.2.0]nona-1,4,6-triene-2-carboxylic acid |
| Molecular Weight |
212.2 |
| Molecular Formula |
C8H4O3S2 |
| Canonical SMILES |
O=C1C=CC=C2C(SS2)=C1C(O)=O |
| InChI |
InChI=1S/C8H4O3S2/c9-4-2-1-3-5-7(13-12-5)6(4)8(10)11/h1-3H,(H,10,11) |
| InChI Key |
BLFCMITWMARUSM-UHFFFAOYSA-N |
| Purity |
95%+ |
| Solubility |
Soluble in DMSO |
| Storage |
Please store the product under the recommended conditions in the Certificate of Analysis. |
| Complexity |
390 |
| Covalently-Bonded Unit Count |
1 |
| Defined Atom Stereocenter Count |
0 |
| Exact Mass |
211.96018633 |
| Heavy Atom Count |
13 |
| Monoisotopic Mass |
211.96018633 |
| Physical State |
Powder |
| Storage Conditions |
Powder: -20°C for 3 years
In solvent: -80°C for 2 years |
| Topological Polar Surface Area |
105 Ų |
For Research Use Only. Not for use in diagnostic or therapeutic procedures.
